![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| acsbaum2.html | 17-Nov-2004 17:02 | 2.2K | |
| betalactam.html | 17-Nov-2004 17:02 | 1.1K | Reaction Schemes |
| betalactamFrame.html | 17-Nov-2004 17:02 | 186 | |
| bioinf.html | 17-Nov-2004 17:02 | 267 | Bioinformatics |
| cheminf.html | 17-Nov-2004 17:02 | 312 | Chemoinformatics |
| chempub.html | 17-Nov-2004 17:02 | 340 | Chemical publication |
| cml0.html | 17-Nov-2004 17:02 | 1.2K | XML in 1 minute |
| cml00.html | 17-Nov-2004 17:02 | 1.2K | Advanced CML |
| cmlArch.html | 17-Nov-2004 17:02 | 243 | CML Architecture |
| cmlcentral.html | 17-Nov-2004 17:02 | 561 | Central role of CML |
| cmlrss2.html | 17-Nov-2004 17:02 | 300 | CMLRSS: "Chemical News Feeds" |
| cml_overview.html | 17-Nov-2004 17:02 | 760 | Overview of CML |
| csw.html | 17-Nov-2004 17:02 | 486 | Chemical Semantic Web |
| cswadopt.html | 17-Nov-2004 17:02 | 1.4K | Adopters of CML/INChI/CSW |
| cswstatus.html | 17-Nov-2004 17:02 | 941 | Status of CSW |
| demo200410.html | 17-Nov-2004 17:02 | 1.2K | Demonstrations |
| dict.html | 17-Nov-2004 17:02 | 597 | Why "semantic" |
| dict2.html | 17-Nov-2004 17:02 | 224 | Dictionary - 2 |
| dict11.html | 17-Nov-2004 17:02 | 220 | Dictionary - 1 |
| epo1.html | 17-Nov-2004 17:02 | 141 | EPO - information loss |
| epo2.html | 17-Nov-2004 17:02 | 151 | EPO - information retention |
| jobcont.html | 17-Nov-2004 17:02 | 235 | Job Control |
| manifesto.html | 17-Nov-2004 17:02 | 1.0K | A Manifesto for Open Chemistry |
| molid.html | 17-Nov-2004 17:02 | 848 | Unique Identifiers for Chemicals |
| molname.html | 17-Nov-2004 17:02 | 1.1K | Names for Chemicals |
| mopacglue.html | 17-Nov-2004 17:02 | 410 | Component-based architecture |
| noloss.html | 17-Nov-2004 17:02 | 239 | Lossless Publication |
| oscar.html | 17-Nov-2004 17:02 | 1.1K | OSCAR text extraction |
| oscarFrame.html | 17-Nov-2004 17:02 | 176 | |
| p2p1.html | 17-Nov-2004 17:02 | 560 | Peer2Peer 1 |
| properties.html | 17-Nov-2004 17:02 | 485 | Molecules and Properties |
| props1.html | 17-Nov-2004 17:02 | 695 | Molecular Properties |
| publoss.html | 17-Nov-2004 17:02 | 404 | Loss during Publication |
| schemamenu.html | 17-Nov-2004 17:02 | 278 | Menu-based Schema |
| stmml.html | 17-Nov-2004 17:02 | 603 | |
| suppdata1.html | 17-Nov-2004 17:02 | 349 | Supplemental Data |
| sweb.html | 17-Nov-2004 17:02 | 819 | Visions for the Chemical Semantic Web |
| threats.html | 17-Nov-2004 17:02 | 669 | Threats and Opportunities |
| wwmm3.html | 17-Nov-2004 17:02 | 646 | The World Wide Molecular Matrix-3 (WWMM) |
| xmlchain.html | 17-Nov-2004 17:02 | 359 | Network of components |